C11H16 — CID 11768723
4,5,6,7-tetramethylspiro[2.4]hepta-4,6-diene (PubChem CID 11768723) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 4,5,6,7-tetramethylspiro[2.4]hepta-4,6-diene.
| Compound Name | 4,5,6,7-tetramethylspiro[2.4]hepta-4,6-diene |
|---|---|
| PubChem CID | 11768723 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 4,5,6,7-tetramethylspiro[2.4]hepta-4,6-diene |
| SMILES | CC1=C(C)C2(CC2)C(C)=C1C |
| InChI | InChI=1S/C11H16/c1-7-8(2)10(4)11(5-6-11)9(7)3/h5-6H2,1-4H3 |
| InChIKey | SFDCZPLGNBKVCY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |