C12H20 — CID 11768906
(1R,4S)-1,2,4,7,7-pentamethylbicyclo[2.2.1]hept-2-ene (PubChem CID 11768906) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (1R,4S)-1,2,4,7,7-pentamethylbicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S)-1,2,4,7,7-pentamethylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 11768906 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (1R,4S)-1,2,4,7,7-pentamethylbicyclo[2.2.1]hept-2-ene |
| SMILES | CC1=C[C@]2(C)CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C12H20/c1-9-8-11(4)6-7-12(9,5)10(11,2)3/h8H,6-7H2,1-5H3/t11-,12+/m0/s1 |
| InChIKey | BANJPTQTXZGDTA-NWDGAFQWSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|