C7H10Br2 — CID 129163382
(3R)-1,3-dibromo-3-methylcyclohexene (PubChem CID 129163382) has the molecular formula C7H10Br2 and a molecular weight of 253.96 g/mol. Its IUPAC name is (3R)-1,3-dibromo-3-methylcyclohexene.
| Compound Name | (3R)-1,3-dibromo-3-methylcyclohexene |
|---|---|
| PubChem CID | 129163382 |
| Molecular Formula | C7H10Br2 |
| Molecular Weight | 253.96 g/mol |
| Exact Mass | 251.91 |
| IUPAC Name | (3R)-1,3-dibromo-3-methylcyclohexene |
| SMILES | C[C@]1(Br)C=C(Br)CCC1 |
| InChI | InChI=1S/C7H10Br2/c1-7(9)4-2-3-6(8)5-7/h5H,2-4H2,1H3/t7-/m1/s1 |
| InChIKey | JIYMFCNESQLLQH-SSDOTTSWSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.96 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|