C9H14Br2 — CID 139627445
1-(dibromomethyl)-3,3-dimethylcyclohexene (PubChem CID 139627445) has the molecular formula C9H14Br2 and a molecular weight of 282.02 g/mol. Its IUPAC name is 1-(dibromomethyl)-3,3-dimethylcyclohexene.
| Compound Name | 1-(dibromomethyl)-3,3-dimethylcyclohexene |
|---|---|
| PubChem CID | 139627445 |
| Molecular Formula | C9H14Br2 |
| Molecular Weight | 282.02 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | 1-(dibromomethyl)-3,3-dimethylcyclohexene |
| SMILES | CC1(C)C=C(C(Br)Br)CCC1 |
| InChI | InChI=1S/C9H14Br2/c1-9(2)5-3-4-7(6-9)8(10)11/h6,8H,3-5H2,1-2H3 |
| InChIKey | XIOYNUVSCQMYEV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.02 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|