C12H18O — CID 123217581
4-(3,3-dimethylcyclohexen-1-yl)but-3-enal (PubChem CID 123217581) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-(3,3-dimethylcyclohexen-1-yl)but-3-enal.
| Compound Name | 4-(3,3-dimethylcyclohexen-1-yl)but-3-enal |
|---|---|
| PubChem CID | 123217581 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-(3,3-dimethylcyclohexen-1-yl)but-3-enal |
| SMILES | CC1(C)C=C(C=CCC=O)CCC1 |
| InChI | InChI=1S/C12H18O/c1-12(2)8-5-7-11(10-12)6-3-4-9-13/h3,6,9-10H,4-5,7-8H2,1-2H3 |
| InChIKey | WABSNOZKGHHDPS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|