C16H28O — CID 143002875
acetaldehyde;(2S,3S)-2,3,8,8-tetramethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene (PubChem CID 143002875) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is acetaldehyde;(2S,3S)-2,3,8,8-tetramethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene.
| Compound Name | acetaldehyde;(2S,3S)-2,3,8,8-tetramethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 143002875 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | acetaldehyde;(2S,3S)-2,3,8,8-tetramethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
| SMILES | CC=O.C[C@H]1CC2=C(C[C@@H]1C)C(C)(C)CCC2 |
| InChI | InChI=1S/C14H24.C2H4O/c1-10-8-12-6-5-7-14(3,4)13(12)9-11(10)2;1-2-3/h10-11H,5-9H2,1-4H3;2H,1H3/t10-,11-;/m0./s1 |
| InChIKey | UAYWSCJTFRVUCN-ACMTZBLWSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|