C19H29NO3 — CID 797255
(2R,3R)-8,8-dimethyl-3-(piperidine-1-carbonyl)-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylic acid (PubChem CID 797255) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is (2R,3R)-8,8-dimethyl-3-(piperidine-1-carbonyl)-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylic acid.
| Compound Name | (2R,3R)-8,8-dimethyl-3-(piperidine-1-carbonyl)-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 797255 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (2R,3R)-8,8-dimethyl-3-(piperidine-1-carbonyl)-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylic acid |
| SMILES | CC1(C)CCCC2=C1C[C@@H](C(=O)O)[C@H](C(=O)N1CCCCC1)C2 |
| InChI | InChI=1S/C19H29NO3/c1-19(2)8-6-7-13-11-14(15(18(22)23)12-16(13)19)17(21)20-9-4-3-5-10-20/h14-15H,3-12H2,1-2H3,(H,22,23)/t14-,15-/m1/s1 |
| InChIKey | OSMRSCRRFQBSNS-HUUCEWRRSA-N |
| XLogP | 3.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|