2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid

C14H23NO3 — CID 120976964

IUPAC2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid
SMILESCC1(C)CCCN(C(=O)C2CCC2C(=O)O)CC1
InChIInChI=1S/C14H23NO3/c1-14(2)6-3-8-15(9-7-14)12(16)10-4-5-11(10)13(17)18/h10-11H,3-9H2,1-2H3,(H,17,18)
InChIKeyXEWZSDBTFHOKMN-UHFFFAOYSA-N
MW253.34 g/mol
LogP2.14
Rot. Bonds2

About 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid

2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid (PubChem CID 120976964) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid
PubChem CID120976964
Molecular FormulaC14H23NO3
Molecular Weight253.34 g/mol
Exact Mass253.17
IUPAC Name2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid
SMILESCC1(C)CCCN(C(=O)C2CCC2C(=O)O)CC1
InChIInChI=1S/C14H23NO3/c1-14(2)6-3-8-15(9-7-14)12(16)10-4-5-11(10)13(17)18/h10-11H,3-9H2,1-2H3,(H,17,18)
InChIKeyXEWZSDBTFHOKMN-UHFFFAOYSA-N
XLogP2.14
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.34
LogP ≤ 52.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid?
The IUPAC name of 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid (CID 120976964) is 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid is CC1(C)CCCN(C(=O)C2CCC2C(=O)O)CC1.
What is the InChIKey of 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid?
The InChIKey is XEWZSDBTFHOKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO3/c1-14(2)6-3-8-15(9-7-14)12(16)10-4-5-11(10)13(17)18/h10-11H,3-9H2,1-2H3,(H,17,18).
What are the key properties of 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid?
2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid has a molecular weight of 253.34 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylazepane-1-carbonyl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 120976964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).