C14H23NO — CID 71929830
cyclopent-3-en-1-yl-(4,4-dimethylazepan-1-yl)methanone (PubChem CID 71929830) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-(4,4-dimethylazepan-1-yl)methanone.
| Compound Name | cyclopent-3-en-1-yl-(4,4-dimethylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 71929830 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | cyclopent-3-en-1-yl-(4,4-dimethylazepan-1-yl)methanone |
| SMILES | CC1(C)CCCN(C(=O)C2CC=CC2)CC1 |
| InChI | InChI=1S/C14H23NO/c1-14(2)8-5-10-15(11-9-14)13(16)12-6-3-4-7-12/h3-4,12H,5-11H2,1-2H3 |
| InChIKey | TWOVYFXYKAVREU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|