C11H17BrO — CID 131870973
2-bromo-3,7,7-trimethylcyclooct-2-en-1-one (PubChem CID 131870973) has the molecular formula C11H17BrO and a molecular weight of 245.16 g/mol. Its IUPAC name is 2-bromo-3,7,7-trimethylcyclooct-2-en-1-one.
| Compound Name | 2-bromo-3,7,7-trimethylcyclooct-2-en-1-one |
|---|---|
| PubChem CID | 131870973 |
| Molecular Formula | C11H17BrO |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-bromo-3,7,7-trimethylcyclooct-2-en-1-one |
| SMILES | CC1=C(Br)C(=O)CC(C)(C)CCC1 |
| InChI | InChI=1S/C11H17BrO/c1-8-5-4-6-11(2,3)7-9(13)10(8)12/h4-7H2,1-3H3 |
| InChIKey | CQJMZMZAUYVDKZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|