C19H26O3 — CID 95565272
[(5aS,10aR)-5a,9,10a-trimethyl-3-oxo-2,5,6,7,8,10-hexahydro-1H-benzo[g]azulen-4-yl] acetate (PubChem CID 95565272) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is [(5aS,10aR)-5a,9,10a-trimethyl-3-oxo-2,5,6,7,8,10-hexahydro-1H-benzo[g]azulen-4-yl] acetate.
| Compound Name | [(5aS,10aR)-5a,9,10a-trimethyl-3-oxo-2,5,6,7,8,10-hexahydro-1H-benzo[g]azulen-4-yl] acetate |
|---|---|
| PubChem CID | 95565272 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [(5aS,10aR)-5a,9,10a-trimethyl-3-oxo-2,5,6,7,8,10-hexahydro-1H-benzo[g]azulen-4-yl] acetate |
| SMILES | CC(=O)OC1=C2C(=O)CC[C@]2(C)CC2=C(C)CCC[C@@]2(C)C1 |
| InChI | InChI=1S/C19H26O3/c1-12-6-5-8-18(3)11-16(22-13(2)20)17-15(21)7-9-19(17,4)10-14(12)18/h5-11H2,1-4H3/t18-,19+/m0/s1 |
| InChIKey | BHSSXACVWYUABP-RBUKOAKNSA-N |
| XLogP | 4.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|