C11H17ClO — CID 72732904
2-chloro-3,7,7-trimethylcyclooct-2-en-1-one (PubChem CID 72732904) has the molecular formula C11H17ClO and a molecular weight of 200.71 g/mol. Its IUPAC name is 2-chloro-3,7,7-trimethylcyclooct-2-en-1-one.
| Compound Name | 2-chloro-3,7,7-trimethylcyclooct-2-en-1-one |
|---|---|
| PubChem CID | 72732904 |
| Molecular Formula | C11H17ClO |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-chloro-3,7,7-trimethylcyclooct-2-en-1-one |
| SMILES | CC1=C(Cl)C(=O)CC(C)(C)CCC1 |
| InChI | InChI=1S/C11H17ClO/c1-8-5-4-6-11(2,3)7-9(13)10(8)12/h4-7H2,1-3H3 |
| InChIKey | QTCXUPFOMVLSHP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|