C9H12O3 — CID 11768950
2-[(4S,5R)-5-ethenyl-2-oxooxan-4-yl]acetaldehyde (PubChem CID 11768950) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-[(4S,5R)-5-ethenyl-2-oxooxan-4-yl]acetaldehyde.
| Compound Name | 2-[(4S,5R)-5-ethenyl-2-oxooxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11768950 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-[(4S,5R)-5-ethenyl-2-oxooxan-4-yl]acetaldehyde |
| SMILES | C=C[C@H]1COC(=O)C[C@@H]1CC=O |
| InChI | InChI=1S/C9H12O3/c1-2-7-6-12-9(11)5-8(7)3-4-10/h2,4,7-8H,1,3,5-6H2/t7-,8-/m0/s1 |
| InChIKey | UQFAYKYVDFHFBM-YUMQZZPRSA-N |
| XLogP | 0.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|