C20H21NO4 — CID 11772139
N-[2-[4,5-dimethoxy-2-[(E)-3-oxoprop-1-enyl]phenyl]ethyl]benzamide (PubChem CID 11772139) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[2-[4,5-dimethoxy-2-[(E)-3-oxoprop-1-enyl]phenyl]ethyl]benzamide.
| Compound Name | N-[2-[4,5-dimethoxy-2-[(E)-3-oxoprop-1-enyl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 11772139 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[2-[4,5-dimethoxy-2-[(E)-3-oxoprop-1-enyl]phenyl]ethyl]benzamide |
| SMILES | COc1cc(/C=C/C=O)c(CCNC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H21NO4/c1-24-18-13-16(9-6-12-22)17(14-19(18)25-2)10-11-21-20(23)15-7-4-3-5-8-15/h3-9,12-14H,10-11H2,1-2H3,(H,21,23)/b9-6+ |
| InChIKey | FCIXVKBFNVNVJU-RMKNXTFCSA-N |
| XLogP | 2.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|