C22H29NO2 — CID 11772153
(3R)-8-(2-methoxyphenyl)-N,N-dipropyl-3,4-dihydro-2H-chromen-3-amine (PubChem CID 11772153) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (3R)-8-(2-methoxyphenyl)-N,N-dipropyl-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | (3R)-8-(2-methoxyphenyl)-N,N-dipropyl-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 11772153 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (3R)-8-(2-methoxyphenyl)-N,N-dipropyl-3,4-dihydro-2H-chromen-3-amine |
| SMILES | CCCN(CCC)[C@H]1COc2c(cccc2-c2ccccc2OC)C1 |
| InChI | InChI=1S/C22H29NO2/c1-4-13-23(14-5-2)18-15-17-9-8-11-20(22(17)25-16-18)19-10-6-7-12-21(19)24-3/h6-12,18H,4-5,13-16H2,1-3H3/t18-/m1/s1 |
| InChIKey | VDFXNGPWAIBQSN-GOSISDBHSA-N |
| XLogP | 4.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |