C19H26N2O3S — CID 11772871
ethyl 2-butylsulfanyl-4-(4-methoxyphenyl)-6-methyl-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 11772871) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is ethyl 2-butylsulfanyl-4-(4-methoxyphenyl)-6-methyl-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 2-butylsulfanyl-4-(4-methoxyphenyl)-6-methyl-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 11772871 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | ethyl 2-butylsulfanyl-4-(4-methoxyphenyl)-6-methyl-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCSC1=NC(c2ccc(OC)cc2)C(C(=O)OCC)=C(C)N1 |
| InChI | InChI=1S/C19H26N2O3S/c1-5-7-12-25-19-20-13(3)16(18(22)24-6-2)17(21-19)14-8-10-15(23-4)11-9-14/h8-11,17H,5-7,12H2,1-4H3,(H,20,21) |
| InChIKey | SMJBZUKEPVLXRM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|