C27H34N2O5S — CID 126344019
ethyl (4R)-6-methyl-4-(3,4,5-trimethoxyphenyl)-2-[(2,4,6-trimethylphenyl)methylsulfanyl]-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 126344019) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is ethyl (4R)-6-methyl-4-(3,4,5-trimethoxyphenyl)-2-[(2,4,6-trimethylphenyl)methylsulfanyl]-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-6-methyl-4-(3,4,5-trimethoxyphenyl)-2-[(2,4,6-trimethylphenyl)methylsulfanyl]-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 126344019 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | ethyl (4R)-6-methyl-4-(3,4,5-trimethoxyphenyl)-2-[(2,4,6-trimethylphenyl)methylsulfanyl]-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(SCc2c(C)cc(C)cc2C)=N[C@@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C27H34N2O5S/c1-9-34-26(30)23-18(5)28-27(35-14-20-16(3)10-15(2)11-17(20)4)29-24(23)19-12-21(31-6)25(33-8)22(13-19)32-7/h10-13,24H,9,14H2,1-8H3,(H,28,29)/t24-/m1/s1 |
| InChIKey | YRTZZNPSPCTBFV-XMMPIXPASA-N |
| XLogP | 5.41 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |