C16H14Cl3NO3 — CID 11773241
2,2,2-trichloroethyl N-(3-naphthalen-2-yl-3-oxopropyl)carbamate (PubChem CID 11773241) has the molecular formula C16H14Cl3NO3 and a molecular weight of 374.65 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(3-naphthalen-2-yl-3-oxopropyl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(3-naphthalen-2-yl-3-oxopropyl)carbamate |
|---|---|
| PubChem CID | 11773241 |
| Molecular Formula | C16H14Cl3NO3 |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2,2,2-trichloroethyl N-(3-naphthalen-2-yl-3-oxopropyl)carbamate |
| SMILES | O=C(NCCC(=O)c1ccc2ccccc2c1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H14Cl3NO3/c17-16(18,19)10-23-15(22)20-8-7-14(21)13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9H,7-8,10H2,(H,20,22) |
| InChIKey | YPSYAJJERVXFHP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|