C18H23NO6S — CID 11773448
methanesulfonate;(1S,14R)-9-methoxy-4-methyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-4,6(17),7,9,15-pentaen-14-ol (PubChem CID 11773448) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is methanesulfonate;(1S,14R)-9-methoxy-4-methyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-4,6(17),7,9,15-pentaen-14-ol.
| Compound Name | methanesulfonate;(1S,14R)-9-methoxy-4-methyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-4,6(17),7,9,15-pentaen-14-ol |
|---|---|
| PubChem CID | 11773448 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | methanesulfonate;(1S,14R)-9-methoxy-4-methyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-4,6(17),7,9,15-pentaen-14-ol |
| SMILES | COc1ccc2c3c1OC1C[C@@H](O)C=C[C@@]31CC[N+](C)=C2.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H20NO3.CH4O3S/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17;1-5(2,3)4/h3-6,10,12,14,19H,7-9H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1/t12-,14?,17-;/m0./s1 |
| InChIKey | MGGRSRVEQIMISG-HVDONWHASA-M |
| XLogP | 0.64 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|