C20H20N6O3 — CID 11773745
1-ethyl-3-[6-(3-hydroxy-4-methoxyphenyl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]urea (PubChem CID 11773745) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 1-ethyl-3-[6-(3-hydroxy-4-methoxyphenyl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[6-(3-hydroxy-4-methoxyphenyl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]urea |
|---|---|
| PubChem CID | 11773745 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-ethyl-3-[6-(3-hydroxy-4-methoxyphenyl)-4-pyrazol-1-yl-1H-benzimidazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2c(-n3cccn3)cc(-c3ccc(OC)c(O)c3)cc2[nH]1 |
| InChI | InChI=1S/C20H20N6O3/c1-3-21-20(28)25-19-23-14-9-13(12-5-6-17(29-2)16(27)11-12)10-15(18(14)24-19)26-8-4-7-22-26/h4-11,27H,3H2,1-2H3,(H3,21,23,24,25,28) |
| InChIKey | JPQHPZDBPAUYHF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |