C14H24NO+ — CID 11775744
(2E)-2-[[(2S)-1,1-dimethylpyrrolidin-1-ium-2-yl]methylidene]-6-methylcyclohexan-1-one (PubChem CID 11775744) has the molecular formula C14H24NO+ and a molecular weight of 222.35 g/mol. Its IUPAC name is (2E)-2-[[(2S)-1,1-dimethylpyrrolidin-1-ium-2-yl]methylidene]-6-methylcyclohexan-1-one.
| Compound Name | (2E)-2-[[(2S)-1,1-dimethylpyrrolidin-1-ium-2-yl]methylidene]-6-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 11775744 |
| Molecular Formula | C14H24NO+ |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.19 |
| IUPAC Name | (2E)-2-[[(2S)-1,1-dimethylpyrrolidin-1-ium-2-yl]methylidene]-6-methylcyclohexan-1-one |
| SMILES | CC1CCC/C(=C\[C@@H]2CCC[N+]2(C)C)C1=O |
| InChI | InChI=1S/C14H24NO/c1-11-6-4-7-12(14(11)16)10-13-8-5-9-15(13,2)3/h10-11,13H,4-9H2,1-3H3/q+1/b12-10+/t11?,13-/m0/s1 |
| InChIKey | BXGGCUDENGKCBU-MYGNHRCSSA-N |
| XLogP | 2.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|