About 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide
11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide (PubChem CID 11776128) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide.
Molecular Properties
| Compound Name | 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide |
| PubChem CID | 11776128 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide |
| SMILES | NC(=O)c1cnc2cc1CCCCCCCC2 |
| InChI | InChI=1S/C14H20N2O/c15-14(17)13-10-16-12-8-6-4-2-1-3-5-7-11(13)9-12/h9-10H,1-8H2,(H2,15,17) |
| InChIKey | GSQGSYORFAHHPP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide?
The IUPAC name of 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide (CID 11776128) is 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide.
What is the SMILES notation for 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide?
The canonical SMILES for 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide is NC(=O)c1cnc2cc1CCCCCCCC2.
What is the InChIKey of 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide?
The InChIKey is GSQGSYORFAHHPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c15-14(17)13-10-16-12-8-6-4-2-1-3-5-7-11(13)9-12/h9-10H,1-8H2,(H2,15,17).
What are the key properties of 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide?
11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide has a molecular weight of 232.33 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-azabicyclo[8.3.1]tetradeca-1(14),10,12-triene-13-carboxamide is sourced from PubChem (CID 11776128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).