C11H13N5O2S — CID 11778366
N-[[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide (PubChem CID 11778366) has the molecular formula C11H13N5O2S and a molecular weight of 279.33 g/mol. Its IUPAC name is N-[[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 11778366 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-[[5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(N=C(N)N)n2)o1 |
| InChI | InChI=1S/C11H13N5O2S/c1-6(17)14-4-7-2-3-9(18-7)8-5-19-11(15-8)16-10(12)13/h2-3,5H,4H2,1H3,(H,14,17)(H4,12,13,15,16) |
| InChIKey | UGINCONQULSMSB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|