C20H25NO — CID 11779289
5-tert-butyl-2-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenol (PubChem CID 11779289) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 5-tert-butyl-2-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenol.
| Compound Name | 5-tert-butyl-2-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 11779289 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 5-tert-butyl-2-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenol |
| SMILES | CC(C)(C)c1ccc(CNC2Cc3ccccc3C2)c(O)c1 |
| InChI | InChI=1S/C20H25NO/c1-20(2,3)17-9-8-16(19(22)12-17)13-21-18-10-14-6-4-5-7-15(14)11-18/h4-9,12,18,21-22H,10-11,13H2,1-3H3 |
| InChIKey | TYLYBNLKJJKKIY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|