C16H16BF2NO2 — CID 59316459
[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-3,5-difluorophenyl]boronic acid (PubChem CID 59316459) has the molecular formula C16H16BF2NO2 and a molecular weight of 303.12 g/mol. Its IUPAC name is [4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-3,5-difluorophenyl]boronic acid.
| Compound Name | [4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-3,5-difluorophenyl]boronic acid |
|---|---|
| PubChem CID | 59316459 |
| Molecular Formula | C16H16BF2NO2 |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-3,5-difluorophenyl]boronic acid |
| SMILES | OB(O)c1cc(F)c(CNC2Cc3ccccc3C2)c(F)c1 |
| InChI | InChI=1S/C16H16BF2NO2/c18-15-7-12(17(21)22)8-16(19)14(15)9-20-13-5-10-3-1-2-4-11(10)6-13/h1-4,7-8,13,20-22H,5-6,9H2 |
| InChIKey | LAXYBNFUKWBLNJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|