C30H30F2N4O2 — CID 67160519
4-[3-[3-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-3,5-difluorophenyl]phenyl]-1,2,4-triazol-1-yl]-2,2-dimethylbutanoic acid (PubChem CID 67160519) has the molecular formula C30H30F2N4O2 and a molecular weight of 516.59 g/mol. Its IUPAC name is 4-[3-[3-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-3,5-difluorophenyl]phenyl]-1,2,4-triazol-1-yl]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[3-[3-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-3,5-difluorophenyl]phenyl]-1,2,4-triazol-1-yl]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 67160519 |
| Molecular Formula | C30H30F2N4O2 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 4-[3-[3-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-3,5-difluorophenyl]phenyl]-1,2,4-triazol-1-yl]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCn1cnc(-c2cccc(-c3cc(F)c(CNC4Cc5ccccc5C4)c(F)c3)c2)n1)C(=O)O |
| InChI | InChI=1S/C30H30F2N4O2/c1-30(2,29(37)38)10-11-36-18-34-28(35-36)22-9-5-8-19(12-22)23-15-26(31)25(27(32)16-23)17-33-24-13-20-6-3-4-7-21(20)14-24/h3-9,12,15-16,18,24,33H,10-11,13-14,17H2,1-2H3,(H,37,38) |
| InChIKey | LYJOKWVJUDDBPJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |