C29H30F2N4O2 — CID 59316579
[3-[3-[3,5-difluoro-4-[(2-phenylethylamino)methyl]phenyl]phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 59316579) has the molecular formula C29H30F2N4O2 and a molecular weight of 504.58 g/mol. Its IUPAC name is [3-[3-[3,5-difluoro-4-[(2-phenylethylamino)methyl]phenyl]phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [3-[3-[3,5-difluoro-4-[(2-phenylethylamino)methyl]phenyl]phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59316579 |
| Molecular Formula | C29H30F2N4O2 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [3-[3-[3,5-difluoro-4-[(2-phenylethylamino)methyl]phenyl]phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCn1cnc(-c2cccc(-c3cc(F)c(CNCCc4ccccc4)c(F)c3)c2)n1 |
| InChI | InChI=1S/C29H30F2N4O2/c1-29(2,3)28(36)37-19-35-18-33-27(34-35)22-11-7-10-21(14-22)23-15-25(30)24(26(31)16-23)17-32-13-12-20-8-5-4-6-9-20/h4-11,14-16,18,32H,12-13,17,19H2,1-3H3 |
| InChIKey | VPMGUJMBZAJOTP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|