C25H27F5N4O2 — CID 67160707
2-cyclohexyl-N-[[2,6-difluoro-4-[3-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 67160707) has the molecular formula C25H27F5N4O2 and a molecular weight of 510.51 g/mol. Its IUPAC name is 2-cyclohexyl-N-[[2,6-difluoro-4-[3-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-cyclohexyl-N-[[2,6-difluoro-4-[3-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67160707 |
| Molecular Formula | C25H27F5N4O2 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 2-cyclohexyl-N-[[2,6-difluoro-4-[3-(1H-1,2,4-triazol-5-yl)phenyl]phenyl]methyl]ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | Fc1cc(-c2cccc(-c3ncn[nH]3)c2)cc(F)c1CNCCC1CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H26F2N4.C2HF3O2/c24-21-12-19(17-7-4-8-18(11-17)23-27-15-28-29-23)13-22(25)20(21)14-26-10-9-16-5-2-1-3-6-16;3-2(4,5)1(6)7/h4,7-8,11-13,15-16,26H,1-3,5-6,9-10,14H2,(H,27,28,29);(H,6,7) |
| InChIKey | LYSHLXQGNVKLBT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|