C16H22N6 — CID 111814480
1-cyclohexyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine (PubChem CID 111814480) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-cyclohexyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111814480 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-cyclohexyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1cccc(-c2ncn[nH]2)c1)NC1CCCCC1 |
| InChI | InChI=1S/C16H22N6/c17-16(21-14-7-2-1-3-8-14)18-10-12-5-4-6-13(9-12)15-19-11-20-22-15/h4-6,9,11,14H,1-3,7-8,10H2,(H3,17,18,21)(H,19,20,22) |
| InChIKey | RNWAAMJHUOTASJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|