C15H20N6 — CID 111814482
N'-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]piperidine-1-carboximidamide (PubChem CID 111814482) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is N'-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]piperidine-1-carboximidamide.
| Compound Name | N'-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111814482 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N'-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\Cc1cccc(-c2ncn[nH]2)c1)N1CCCCC1 |
| InChI | InChI=1S/C15H20N6/c16-15(21-7-2-1-3-8-21)17-10-12-5-4-6-13(9-12)14-18-11-19-20-14/h4-6,9,11H,1-3,7-8,10H2,(H2,16,17)(H,18,19,20) |
| InChIKey | NJHHTWLVGULXPX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|