C20H24N6 — CID 111814478
1-(4-butan-2-ylphenyl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine (PubChem CID 111814478) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 1-(4-butan-2-ylphenyl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111814478 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
| SMILES | CCC(C)c1ccc(N/C(N)=N/Cc2cccc(-c3ncn[nH]3)c2)cc1 |
| InChI | InChI=1S/C20H24N6/c1-3-14(2)16-7-9-18(10-8-16)25-20(21)22-12-15-5-4-6-17(11-15)19-23-13-24-26-19/h4-11,13-14H,3,12H2,1-2H3,(H3,21,22,25)(H,23,24,26) |
| InChIKey | ZPQDFKXOPLCFFJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|