C31H33F2N3O2 — CID 58276572
[3-[3-[3,5-difluoro-4-(5-phenylpentyl)phenyl]phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 58276572) has the molecular formula C31H33F2N3O2 and a molecular weight of 517.62 g/mol. Its IUPAC name is [3-[3-[3,5-difluoro-4-(5-phenylpentyl)phenyl]phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [3-[3-[3,5-difluoro-4-(5-phenylpentyl)phenyl]phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58276572 |
| Molecular Formula | C31H33F2N3O2 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | [3-[3-[3,5-difluoro-4-(5-phenylpentyl)phenyl]phenyl]-1,2,4-triazol-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCn1cnc(-c2cccc(-c3cc(F)c(CCCCCc4ccccc4)c(F)c3)c2)n1 |
| InChI | InChI=1S/C31H33F2N3O2/c1-31(2,3)30(37)38-21-36-20-34-29(35-36)24-15-10-14-23(17-24)25-18-27(32)26(28(33)19-25)16-9-5-8-13-22-11-6-4-7-12-22/h4,6-7,10-12,14-15,17-20H,5,8-9,13,16,21H2,1-3H3 |
| InChIKey | NMLRKFIRQMHSIA-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|