C8H11IO2 — CID 11780426
ethyl (2E,4E)-5-iodo-3-methylpenta-2,4-dienoate (PubChem CID 11780426) has the molecular formula C8H11IO2 and a molecular weight of 266.08 g/mol. Its IUPAC name is ethyl (2E,4E)-5-iodo-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-iodo-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 11780426 |
| Molecular Formula | C8H11IO2 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | ethyl (2E,4E)-5-iodo-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/I |
| InChI | InChI=1S/C8H11IO2/c1-3-11-8(10)6-7(2)4-5-9/h4-6H,3H2,1-2H3/b5-4+,7-6+ |
| InChIKey | IRENBIOKVOANHZ-YTXTXJHMSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|