About 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine
2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine (PubChem CID 11781980) has the molecular formula C10H14Cl2N2
and a molecular weight of 233.14 g/mol. Its IUPAC name is 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine |
| PubChem CID | 11781980 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine |
| SMILES | Nc1ccccc1N(CCCl)CCCl |
| InChI | InChI=1S/C10H14Cl2N2/c11-5-7-14(8-6-12)10-4-2-1-3-9(10)13/h1-4H,5-8,13H2 |
| InChIKey | REUUVTULEYHTCC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine?
The IUPAC name of 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine (CID 11781980) is 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine.
What is the SMILES notation for 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine?
The canonical SMILES for 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine is Nc1ccccc1N(CCCl)CCCl.
What is the InChIKey of 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine?
The InChIKey is REUUVTULEYHTCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Cl2N2/c11-5-7-14(8-6-12)10-4-2-1-3-9(10)13/h1-4H,5-8,13H2.
What are the key properties of 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine?
2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine has a molecular weight of 233.14 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine is sourced from PubChem (CID 11781980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).