C18H23NO5 — CID 11782562
N-[(1R,2S,3S,4S,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-N-prop-2-enylacetamide (PubChem CID 11782562) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is N-[(1R,2S,3S,4S,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-N-prop-2-enylacetamide.
| Compound Name | N-[(1R,2S,3S,4S,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 11782562 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-[(1R,2S,3S,4S,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(C)=O)[C@H]1[C@H](O)[C@H]2CO[C@H](O2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO5/c1-3-9-19(12(2)20)15-16(21)14-11-23-18(24-14)17(15)22-10-13-7-5-4-6-8-13/h3-8,14-18,21H,1,9-11H2,2H3/t14-,15+,16-,17+,18-/m1/s1 |
| InChIKey | LTYNEFDISQRURX-MDMSPXHWSA-N |
| XLogP | 1.09 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|