C17H28O8 — CID 11783353
4,4-bis[(2-methylpropan-2-yl)oxycarbonyl]heptanedioic acid (PubChem CID 11783353) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is 4,4-bis[(2-methylpropan-2-yl)oxycarbonyl]heptanedioic acid.
| Compound Name | 4,4-bis[(2-methylpropan-2-yl)oxycarbonyl]heptanedioic acid |
|---|---|
| PubChem CID | 11783353 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 4,4-bis[(2-methylpropan-2-yl)oxycarbonyl]heptanedioic acid |
| SMILES | CC(C)(C)OC(=O)C(CCC(=O)O)(CCC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28O8/c1-15(2,3)24-13(22)17(9-7-11(18)19,10-8-12(20)21)14(23)25-16(4,5)6/h7-10H2,1-6H3,(H,18,19)(H,20,21) |
| InChIKey | HWBQYRUXYHKUCU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|