C22H15F3N2 — CID 11783447
N-[(Z)-(2,2,2-trifluoro-1-phenanthren-9-ylethylidene)amino]aniline (PubChem CID 11783447) has the molecular formula C22H15F3N2 and a molecular weight of 364.37 g/mol. Its IUPAC name is N-[(Z)-(2,2,2-trifluoro-1-phenanthren-9-ylethylidene)amino]aniline.
| Compound Name | N-[(Z)-(2,2,2-trifluoro-1-phenanthren-9-ylethylidene)amino]aniline |
|---|---|
| PubChem CID | 11783447 |
| Molecular Formula | C22H15F3N2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[(Z)-(2,2,2-trifluoro-1-phenanthren-9-ylethylidene)amino]aniline |
| SMILES | FC(F)(F)/C(=N\Nc1ccccc1)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C22H15F3N2/c23-22(24,25)21(27-26-16-9-2-1-3-10-16)20-14-15-8-4-5-11-17(15)18-12-6-7-13-19(18)20/h1-14,26H/b27-21- |
| InChIKey | TXQMEMFKFALOHZ-MEFGMAGPSA-N |
| XLogP | 6.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|