C18H17N5OS2 — CID 11783932
N-[(Z)-(2,5-dimethylphenyl)methylideneamino]-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 11783932) has the molecular formula C18H17N5OS2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-[(Z)-(2,5-dimethylphenyl)methylideneamino]-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(Z)-(2,5-dimethylphenyl)methylideneamino]-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 11783932 |
| Molecular Formula | C18H17N5OS2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-[(Z)-(2,5-dimethylphenyl)methylideneamino]-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1ccc(C)c(/C=N\NC(=O)CSc2nnc(-c3ccccn3)s2)c1 |
| InChI | InChI=1S/C18H17N5OS2/c1-12-6-7-13(2)14(9-12)10-20-21-16(24)11-25-18-23-22-17(26-18)15-5-3-4-8-19-15/h3-10H,11H2,1-2H3,(H,21,24)/b20-10- |
| InChIKey | OTKOMQSDMVRQKP-JMIUGGIZSA-N |
| XLogP | 3.46 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|