C17H15N5OS2 — CID 10893952
N-[(Z)-(2-methylphenyl)methylideneamino]-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 10893952) has the molecular formula C17H15N5OS2 and a molecular weight of 369.48 g/mol. Its IUPAC name is N-[(Z)-(2-methylphenyl)methylideneamino]-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(Z)-(2-methylphenyl)methylideneamino]-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 10893952 |
| Molecular Formula | C17H15N5OS2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | N-[(Z)-(2-methylphenyl)methylideneamino]-2-[(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1ccccc1/C=N\NC(=O)CSc1nnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C17H15N5OS2/c1-12-6-2-3-7-13(12)10-19-20-15(23)11-24-17-22-21-16(25-17)14-8-4-5-9-18-14/h2-10H,11H2,1H3,(H,20,23)/b19-10- |
| InChIKey | YXJBVVPPXPXOER-GRSHGNNSSA-N |
| XLogP | 3.15 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|