C10H16F6N2 — CID 117841645
2,6-Dimethyl-1,4-bis(2,2,2-trifluoroethyl)piperazine (PubChem CID 117841645) has the molecular formula C10H16F6N2 and a molecular weight of 278.24 g/mol. Its IUPAC name is 2,6-dimethyl-1,4-bis(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 2,6-Dimethyl-1,4-bis(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 117841645 |
| Molecular Formula | C10H16F6N2 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2,6-dimethyl-1,4-bis(2,2,2-trifluoroethyl)piperazine |
| SMILES | CC1CN(CC(N1CC(F)(F)F)C)CC(F)(F)F |
| InChI | InChI=1S/C10H16F6N2/c1-7-3-17(5-9(11,12)13)4-8(2)18(7)6-10(14,15)16/h7-8H,3-6H2,1-2H3 |
| InChIKey | LYPVOQVGSRNTQW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 6.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 263 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |