C17H25F14N3 — CID 21026477
N-[2-[butan-2-yl(propyl)amino]ethyl]-N'-(1,1-difluoroethyl)-1,1-difluoro-N,N'-bis(1,1,2,2,2-pentafluoroethyl)ethane-1,2-diamine (PubChem CID 21026477) has the molecular formula C17H25F14N3 and a molecular weight of 537.38 g/mol. Its IUPAC name is N-[2-[butan-2-yl(propyl)amino]ethyl]-N'-(1,1-difluoroethyl)-1,1-difluoro-N,N'-bis(1,1,2,2,2-pentafluoroethyl)ethane-1,2-diamine.
| Compound Name | N-[2-[butan-2-yl(propyl)amino]ethyl]-N'-(1,1-difluoroethyl)-1,1-difluoro-N,N'-bis(1,1,2,2,2-pentafluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 21026477 |
| Molecular Formula | C17H25F14N3 |
| Molecular Weight | 537.38 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | N-[2-[butan-2-yl(propyl)amino]ethyl]-N'-(1,1-difluoroethyl)-1,1-difluoro-N,N'-bis(1,1,2,2,2-pentafluoroethyl)ethane-1,2-diamine |
| SMILES | CCCN(CCN(C(F)(F)CN(C(C)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(C)CC |
| InChI | InChI=1S/C17H25F14N3/c1-5-7-32(11(3)6-2)8-9-33(16(28,29)14(22,23)24)13(20,21)10-34(12(4,18)19)17(30,31)15(25,26)27/h11H,5-10H2,1-4H3 |
| InChIKey | GJOMKYUPKNCPCV-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.38 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|