C23H44F9N7 — CID 88589865
1,4,13,20-tetramethyl-7,10,17-tris(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane (PubChem CID 88589865) has the molecular formula C23H44F9N7 and a molecular weight of 589.64 g/mol. Its IUPAC name is 1,4,13,20-tetramethyl-7,10,17-tris(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane.
| Compound Name | 1,4,13,20-tetramethyl-7,10,17-tris(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane |
|---|---|
| PubChem CID | 88589865 |
| Molecular Formula | C23H44F9N7 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.35 |
| IUPAC Name | 1,4,13,20-tetramethyl-7,10,17-tris(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane |
| SMILES | CN1CCCN(C)CCN(C(F)(F)F)CCCN(C)CCN(C(F)(F)F)CCN(C(F)(F)F)CCN(C)CC1 |
| InChI | InChI=1S/C23H44F9N7/c1-33-7-5-8-34(2)13-16-37(21(24,25)26)10-6-9-35(3)14-17-38(22(27,28)29)19-20-39(23(30,31)32)18-15-36(4)12-11-33/h5-20H2,1-4H3 |
| InChIKey | QDKDFLPXZYUDCH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 22.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|