C23H41F12N7 — CID 88589866
1,4,20-trimethyl-7,10,13,17-tetrakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane (PubChem CID 88589866) has the molecular formula C23H41F12N7 and a molecular weight of 643.61 g/mol. Its IUPAC name is 1,4,20-trimethyl-7,10,13,17-tetrakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane.
| Compound Name | 1,4,20-trimethyl-7,10,13,17-tetrakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane |
|---|---|
| PubChem CID | 88589866 |
| Molecular Formula | C23H41F12N7 |
| Molecular Weight | 643.61 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | 1,4,20-trimethyl-7,10,13,17-tetrakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane |
| SMILES | CN1CCCN(C)CCN(C(F)(F)F)CCCN(C(F)(F)F)CCN(C(F)(F)F)CCN(C(F)(F)F)CCN(C)CC1 |
| InChI | InChI=1S/C23H41F12N7/c1-36-6-4-7-37(2)12-14-39(20(24,25)26)8-5-9-40(21(27,28)29)16-17-42(23(33,34)35)19-18-41(22(30,31)32)15-13-38(3)11-10-36/h4-19H2,1-3H3 |
| InChIKey | XYYANAMHYZKUFJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 22.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|