C10H17F5N2 — CID 118973761
(2R,6S)-2,4,6-trimethyl-1-(2,2,3,3,3-pentafluoropropyl)piperazine (PubChem CID 118973761) has the molecular formula C10H17F5N2 and a molecular weight of 260.25 g/mol. Its IUPAC name is (2R,6S)-2,4,6-trimethyl-1-(2,2,3,3,3-pentafluoropropyl)piperazine.
| Compound Name | (2R,6S)-2,4,6-trimethyl-1-(2,2,3,3,3-pentafluoropropyl)piperazine |
|---|---|
| PubChem CID | 118973761 |
| Molecular Formula | C10H17F5N2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (2R,6S)-2,4,6-trimethyl-1-(2,2,3,3,3-pentafluoropropyl)piperazine |
| SMILES | C[C@@H]1CN(C)C[C@H](C)N1CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H17F5N2/c1-7-4-16(3)5-8(2)17(7)6-9(11,12)10(13,14)15/h7-8H,4-6H2,1-3H3/t7-,8+ |
| InChIKey | KWCHGEIJSRTBRP-OCAPTIKFSA-N |
| XLogP | 2.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|