C27H25N3O7 — CID 11785380
2-amino-5-[2-methyl-1-[(3,4,5-trimethoxybenzoyl)amino]indolizine-3-carbonyl]benzoic acid (PubChem CID 11785380) has the molecular formula C27H25N3O7 and a molecular weight of 503.51 g/mol. Its IUPAC name is 2-amino-5-[2-methyl-1-[(3,4,5-trimethoxybenzoyl)amino]indolizine-3-carbonyl]benzoic acid.
| Compound Name | 2-amino-5-[2-methyl-1-[(3,4,5-trimethoxybenzoyl)amino]indolizine-3-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 11785380 |
| Molecular Formula | C27H25N3O7 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 2-amino-5-[2-methyl-1-[(3,4,5-trimethoxybenzoyl)amino]indolizine-3-carbonyl]benzoic acid |
| SMILES | COc1cc(C(=O)Nc2c(C)c(C(=O)c3ccc(N)c(C(=O)O)c3)n3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C27H25N3O7/c1-14-22(29-26(32)16-12-20(35-2)25(37-4)21(13-16)36-3)19-7-5-6-10-30(19)23(14)24(31)15-8-9-18(28)17(11-15)27(33)34/h5-13H,28H2,1-4H3,(H,29,32)(H,33,34) |
| InChIKey | OGPCYEHDQUAYHJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|