C20H20N6O4 — CID 168603275
2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-(1-methoxy-2-methylindolizine-3-carbonyl)benzoic acid (PubChem CID 168603275) has the molecular formula C20H20N6O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-(1-methoxy-2-methylindolizine-3-carbonyl)benzoic acid.
| Compound Name | 2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-(1-methoxy-2-methylindolizine-3-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 168603275 |
| Molecular Formula | C20H20N6O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-(1-methoxy-2-methylindolizine-3-carbonyl)benzoic acid |
| SMILES | COc1c(C)c(C(=O)c2ccc(/N=C(\N)N=C(N)N)c(C(=O)O)c2)n2ccccc12 |
| InChI | InChI=1S/C20H20N6O4/c1-10-15(26-8-4-3-5-14(26)17(10)30-2)16(27)11-6-7-13(12(9-11)18(28)29)24-20(23)25-19(21)22/h3-9H,1-2H3,(H,28,29)(H6,21,22,23,24,25) |
| InChIKey | XNPCJKUHLRPDPL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 170.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|