C31H61N3O2Si — CID 11785971
(Z,2S,3R)-2-azido-3-[tert-butyl(dimethyl)silyl]oxy-12-[(1R,2S)-2-decylcyclopropyl]dodec-7-en-1-ol (PubChem CID 11785971) has the molecular formula C31H61N3O2Si and a molecular weight of 535.93 g/mol. Its IUPAC name is (Z,2S,3R)-2-azido-3-[tert-butyl(dimethyl)silyl]oxy-12-[(1R,2S)-2-decylcyclopropyl]dodec-7-en-1-ol.
| Compound Name | (Z,2S,3R)-2-azido-3-[tert-butyl(dimethyl)silyl]oxy-12-[(1R,2S)-2-decylcyclopropyl]dodec-7-en-1-ol |
|---|---|
| PubChem CID | 11785971 |
| Molecular Formula | C31H61N3O2Si |
| Molecular Weight | 535.93 g/mol |
| Exact Mass | 535.45 |
| IUPAC Name | (Z,2S,3R)-2-azido-3-[tert-butyl(dimethyl)silyl]oxy-12-[(1R,2S)-2-decylcyclopropyl]dodec-7-en-1-ol |
| SMILES | CCCCCCCCCC[C@H]1C[C@H]1CCCC/C=C\CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C31H61N3O2Si/c1-7-8-9-10-11-13-16-19-22-27-25-28(27)23-20-17-14-12-15-18-21-24-30(29(26-35)33-34-32)36-37(5,6)31(2,3)4/h12,15,27-30,35H,7-11,13-14,16-26H2,1-6H3/b15-12-/t27-,28+,29-,30+/m0/s1 |
| InChIKey | VHUHJXQJPPJJPI-KVBMNSPCSA-N |
| XLogP | 10.50 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.93 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|