C22H40O — CID 167614180
3,3-dimethyl-9-[2-[(Z)-oct-2-enyl]cyclopropyl]nonan-2-one (PubChem CID 167614180) has the molecular formula C22H40O and a molecular weight of 320.56 g/mol. Its IUPAC name is 3,3-dimethyl-9-[2-[(Z)-oct-2-enyl]cyclopropyl]nonan-2-one.
| Compound Name | 3,3-dimethyl-9-[2-[(Z)-oct-2-enyl]cyclopropyl]nonan-2-one |
|---|---|
| PubChem CID | 167614180 |
| Molecular Formula | C22H40O |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.31 |
| IUPAC Name | 3,3-dimethyl-9-[2-[(Z)-oct-2-enyl]cyclopropyl]nonan-2-one |
| SMILES | CCCCC/C=C\CC1CC1CCCCCCC(C)(C)C(C)=O |
| InChI | InChI=1S/C22H40O/c1-5-6-7-8-9-12-15-20-18-21(20)16-13-10-11-14-17-22(3,4)19(2)23/h9,12,20-21H,5-8,10-11,13-18H2,1-4H3/b12-9- |
| InChIKey | AWZFFXKRKRVIEH-XFXZXTDPSA-N |
| XLogP | 7.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|