C34H26Cl2N5OsP — CID 11787646
dichloroosmium;2,6-dipyridin-2-ylpyridine;(triphenyl-λ5-phosphanylidene)cyanamide (PubChem CID 11787646) has the molecular formula C34H26Cl2N5OsP and a molecular weight of 796.73 g/mol. Its IUPAC name is dichloroosmium;2,6-dipyridin-2-ylpyridine;(triphenyl-λ5-phosphanylidene)cyanamide.
| Compound Name | dichloroosmium;2,6-dipyridin-2-ylpyridine;(triphenyl-λ5-phosphanylidene)cyanamide |
|---|---|
| PubChem CID | 11787646 |
| Molecular Formula | C34H26Cl2N5OsP |
| Molecular Weight | 796.73 g/mol |
| Exact Mass | 797.09 |
| IUPAC Name | dichloroosmium;2,6-dipyridin-2-ylpyridine;(triphenyl-λ5-phosphanylidene)cyanamide |
| SMILES | Cl[Os]Cl.N#CN=P(c1ccccc1)(c1ccccc1)c1ccccc1.c1ccc(-c2cccc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C19H15N2P.C15H11N3.2ClH.Os/c20-16-21-22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13;;;/h1-15H;1-11H;2*1H;/q;;;;+2/p-2 |
| InChIKey | OSZJOWVYJLUGMD-UHFFFAOYSA-L |
| XLogP | 8.23 |
| TPSA | 74.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.73 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|