C26H28N6 — CID 5519
N,N,N',N'-tetrakis(pyridin-2-ylmethyl)ethane-1,2-diamine (PubChem CID 5519) has the molecular formula C26H28N6 and a molecular weight of 424.55 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(pyridin-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrakis(pyridin-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 5519 |
| Molecular Formula | C26H28N6 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N,N,N',N'-tetrakis(pyridin-2-ylmethyl)ethane-1,2-diamine |
| SMILES | c1ccc(CN(CCN(Cc2ccccn2)Cc2ccccn2)Cc2ccccn2)nc1 |
| InChI | InChI=1S/C26H28N6/c1-5-13-27-23(9-1)19-31(20-24-10-2-6-14-28-24)17-18-32(21-25-11-3-7-15-29-25)22-26-12-4-8-16-30-26/h1-16H,17-22H2 |
| InChIKey | CVRXLMUYFMERMJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |